C25H31NO9S — CID 101041866
[(3R,4S,5R)-4-[(4-methoxyphenyl)methoxy]-5-methylsulfonyloxy-6-(phenylmethoxycarbonylamino)hex-1-en-3-yl] acetate (PubChem CID 101041866) has the molecular formula C25H31NO9S and a molecular weight of 521.59 g/mol. Its IUPAC name is [(3R,4S,5R)-4-[(4-methoxyphenyl)methoxy]-5-methylsulfonyloxy-6-(phenylmethoxycarbonylamino)hex-1-en-3-yl] acetate.
| Compound Name | [(3R,4S,5R)-4-[(4-methoxyphenyl)methoxy]-5-methylsulfonyloxy-6-(phenylmethoxycarbonylamino)hex-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 101041866 |
| Molecular Formula | C25H31NO9S |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | [(3R,4S,5R)-4-[(4-methoxyphenyl)methoxy]-5-methylsulfonyloxy-6-(phenylmethoxycarbonylamino)hex-1-en-3-yl] acetate |
| SMILES | C=C[C@@H](OC(C)=O)[C@H](OCc1ccc(OC)cc1)[C@@H](CNC(=O)OCc1ccccc1)OS(C)(=O)=O |
| InChI | InChI=1S/C25H31NO9S/c1-5-22(34-18(2)27)24(32-16-20-11-13-21(31-3)14-12-20)23(35-36(4,29)30)15-26-25(28)33-17-19-9-7-6-8-10-19/h5-14,22-24H,1,15-17H2,2-4H3,(H,26,28)/t22-,23-,24+/m1/s1 |
| InChIKey | NUFXDZZKOPRSBE-SMIHKQSGSA-N |
| XLogP | 2.97 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|