C28H47IO5Si — CID 134990657
(2R,3S,5S)-5-[(3R,5S)-5-(iodomethyl)oxolan-3-yl]-5-[(4-methoxyphenyl)methoxy]-2-methyl-3-tri(propan-2-yl)silyloxypentanal (PubChem CID 134990657) has the molecular formula C28H47IO5Si and a molecular weight of 618.67 g/mol. Its IUPAC name is (2R,3S,5S)-5-[(3R,5S)-5-(iodomethyl)oxolan-3-yl]-5-[(4-methoxyphenyl)methoxy]-2-methyl-3-tri(propan-2-yl)silyloxypentanal.
| Compound Name | (2R,3S,5S)-5-[(3R,5S)-5-(iodomethyl)oxolan-3-yl]-5-[(4-methoxyphenyl)methoxy]-2-methyl-3-tri(propan-2-yl)silyloxypentanal |
|---|---|
| PubChem CID | 134990657 |
| Molecular Formula | C28H47IO5Si |
| Molecular Weight | 618.67 g/mol |
| Exact Mass | 618.22 |
| IUPAC Name | (2R,3S,5S)-5-[(3R,5S)-5-(iodomethyl)oxolan-3-yl]-5-[(4-methoxyphenyl)methoxy]-2-methyl-3-tri(propan-2-yl)silyloxypentanal |
| SMILES | COc1ccc(CO[C@@H](C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)C=O)[C@H]2CO[C@H](CI)C2)cc1 |
| InChI | InChI=1S/C28H47IO5Si/c1-19(2)35(20(3)4,21(5)6)34-27(22(7)16-30)14-28(24-13-26(15-29)32-18-24)33-17-23-9-11-25(31-8)12-10-23/h9-12,16,19-22,24,26-28H,13-15,17-18H2,1-8H3/t22-,24+,26-,27-,28-/m0/s1 |
| InChIKey | WDFKIMPZYVTDHB-FTISQDLESA-N |
| XLogP | 7.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.67 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|