C17H26O — CID 134991831
[(3R,4S)-2,4-dimethyl-5-methylideneheptan-3-yl]oxymethylbenzene (PubChem CID 134991831) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is [(3R,4S)-2,4-dimethyl-5-methylideneheptan-3-yl]oxymethylbenzene.
| Compound Name | [(3R,4S)-2,4-dimethyl-5-methylideneheptan-3-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 134991831 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | [(3R,4S)-2,4-dimethyl-5-methylideneheptan-3-yl]oxymethylbenzene |
| SMILES | C=C(CC)[C@H](C)[C@H](OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C17H26O/c1-6-14(4)15(5)17(13(2)3)18-12-16-10-8-7-9-11-16/h7-11,13,15,17H,4,6,12H2,1-3,5H3/t15-,17+/m0/s1 |
| InChIKey | SCAHVWAZJCDYKQ-DOTOQJQBSA-N |
| XLogP | 4.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|