C54H36AlBr3O3 — CID 134992150
(3-bromo-2,6-diphenylphenoxy)-bis(4-bromo-2,6-diphenylphenoxy)alumane (PubChem CID 134992150) has the molecular formula C54H36AlBr3O3 and a molecular weight of 999.57 g/mol. Its IUPAC name is (3-bromo-2,6-diphenylphenoxy)-bis(4-bromo-2,6-diphenylphenoxy)alumane.
| Compound Name | (3-bromo-2,6-diphenylphenoxy)-bis(4-bromo-2,6-diphenylphenoxy)alumane |
|---|---|
| PubChem CID | 134992150 |
| Molecular Formula | C54H36AlBr3O3 |
| Molecular Weight | 999.57 g/mol |
| Exact Mass | 996.00 |
| IUPAC Name | (3-bromo-2,6-diphenylphenoxy)-bis(4-bromo-2,6-diphenylphenoxy)alumane |
| SMILES | Brc1cc(-c2ccccc2)c(O[Al](Oc2c(-c3ccccc3)cc(Br)cc2-c2ccccc2)Oc2c(-c3ccccc3)ccc(Br)c2-c2ccccc2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/3C18H13BrO.Al/c2*19-15-11-16(13-7-3-1-4-8-13)18(20)17(12-15)14-9-5-2-6-10-14;19-16-12-11-15(13-7-3-1-4-8-13)18(20)17(16)14-9-5-2-6-10-14;/h3*1-12,20H;/q;;;+3/p-3 |
| InChIKey | OMPKEQYWHLQBJD-UHFFFAOYSA-K |
| XLogP | 16.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.57 |
| LogP ≤ 5 | 16.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |