C10H12O — CID 134992626
3-ethynyl-2,2-bis[(E)-prop-1-enyl]oxirane (PubChem CID 134992626) has the molecular formula C10H12O and a molecular weight of 148.20 g/mol. Its IUPAC name is 3-ethynyl-2,2-bis[(E)-prop-1-enyl]oxirane.
| Compound Name | 3-ethynyl-2,2-bis[(E)-prop-1-enyl]oxirane |
|---|---|
| PubChem CID | 134992626 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 3-ethynyl-2,2-bis[(E)-prop-1-enyl]oxirane |
| SMILES | C#CC1OC1(/C=C/C)/C=C/C |
| InChI | InChI=1S/C10H12O/c1-4-7-10(8-5-2)9(6-3)11-10/h3-5,7-9H,1-2H3/b7-4+,8-5+ |
| InChIKey | ZKBVRPCKCJVUKT-NSLJXJERSA-N |
| XLogP | 1.91 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|