C16H28O2 — CID 134993329
(7Z,9E)-5-hydroxy-5,10-dimethyltetradeca-7,9-dien-6-one (PubChem CID 134993329) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (7Z,9E)-5-hydroxy-5,10-dimethyltetradeca-7,9-dien-6-one.
| Compound Name | (7Z,9E)-5-hydroxy-5,10-dimethyltetradeca-7,9-dien-6-one |
|---|---|
| PubChem CID | 134993329 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (7Z,9E)-5-hydroxy-5,10-dimethyltetradeca-7,9-dien-6-one |
| SMILES | CCCC/C(C)=C/C=C\C(=O)C(C)(O)CCCC |
| InChI | InChI=1S/C16H28O2/c1-5-7-10-14(3)11-9-12-15(17)16(4,18)13-8-6-2/h9,11-12,18H,5-8,10,13H2,1-4H3/b12-9-,14-11+ |
| InChIKey | OFRDIBHCMZWEMY-MMFCQQQJSA-N |
| XLogP | 4.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|