C7H15NO — CID 134995456
2,3,6-trimethyloxazinane (PubChem CID 134995456) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is 2,3,6-trimethyloxazinane.
| Compound Name | 2,3,6-trimethyloxazinane |
|---|---|
| PubChem CID | 134995456 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | 2,3,6-trimethyloxazinane |
| SMILES | CC1CCC(C)N(C)O1 |
| InChI | InChI=1S/C7H15NO/c1-6-4-5-7(2)9-8(6)3/h6-7H,4-5H2,1-3H3 |
| InChIKey | BGSSASWDBRQUBN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |