C6H14NP — CID 143476890
(2,5-dimethylpyrrolidin-1-yl)phosphane (PubChem CID 143476890) has the molecular formula C6H14NP and a molecular weight of 131.16 g/mol. Its IUPAC name is (2,5-dimethylpyrrolidin-1-yl)phosphane.
| Compound Name | (2,5-dimethylpyrrolidin-1-yl)phosphane |
|---|---|
| PubChem CID | 143476890 |
| Molecular Formula | C6H14NP |
| Molecular Weight | 131.16 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | (2,5-dimethylpyrrolidin-1-yl)phosphane |
| SMILES | CC1CCC(C)N1P |
| InChI | InChI=1S/C6H14NP/c1-5-3-4-6(2)7(5)8/h5-6H,3-4,8H2,1-2H3 |
| InChIKey | ZAWYMBZMOQNLDO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.16 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|