About CID 169243446
CID 169243446 (PubChem CID 169243446) has the molecular formula C6H12BBrN
and a molecular weight of 188.88 g/mol.
Molecular Properties
| Compound Name | CID 169243446 |
| PubChem CID | 169243446 |
| Molecular Formula | C6H12BBrN |
| Molecular Weight | 188.88 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | — |
| SMILES | CC1CCC(C)N1[B]Br |
| InChI | InChI=1S/C6H12BBrN/c1-5-3-4-6(2)9(5)7-8/h5-6H,3-4H2,1-2H3 |
| InChIKey | MTVZEAZEMMAMBX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.88 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 169243446 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169243446?
The IUPAC name of CID 169243446 (CID 169243446) is not available.
What is the SMILES notation for CID 169243446?
The canonical SMILES for CID 169243446 is CC1CCC(C)N1[B]Br.
What is the InChIKey of CID 169243446?
The InChIKey is MTVZEAZEMMAMBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12BBrN/c1-5-3-4-6(2)9(5)7-8/h5-6H,3-4H2,1-2H3.
What are the key properties of CID 169243446?
CID 169243446 has a molecular weight of 188.88 g/mol, XLogP of 1.79, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169243446 is sourced from PubChem (CID 169243446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).