C8H17NO2 — CID 141126666
1-hydroperoxy-2,3,6-trimethylpiperidine (PubChem CID 141126666) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is 1-hydroperoxy-2,3,6-trimethylpiperidine.
| Compound Name | 1-hydroperoxy-2,3,6-trimethylpiperidine |
|---|---|
| PubChem CID | 141126666 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 1-hydroperoxy-2,3,6-trimethylpiperidine |
| SMILES | CC1CCC(C)N(OO)C1C |
| InChI | InChI=1S/C8H17NO2/c1-6-4-5-7(2)9(11-10)8(6)3/h6-8,10H,4-5H2,1-3H3 |
| InChIKey | WLEXJCUFFVMZFE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|