C6H13NO — CID 67660109
1-hydroxy-2,3-dimethylpyrrolidine (PubChem CID 67660109) has the molecular formula C6H13NO and a molecular weight of 115.18 g/mol. Its IUPAC name is 1-hydroxy-2,3-dimethylpyrrolidine.
| Compound Name | 1-hydroxy-2,3-dimethylpyrrolidine |
|---|---|
| PubChem CID | 67660109 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | 1-hydroxy-2,3-dimethylpyrrolidine |
| SMILES | CC1CCN(O)C1C |
| InChI | InChI=1S/C6H13NO/c1-5-3-4-7(8)6(5)2/h5-6,8H,3-4H2,1-2H3 |
| InChIKey | QVCLWLJLPNHTFJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |