C6H14N2 — CID 121486314
2,3-dimethylpyrrolidin-1-amine (PubChem CID 121486314) has the molecular formula C6H14N2 and a molecular weight of 114.19 g/mol. Its IUPAC name is 2,3-dimethylpyrrolidin-1-amine.
| Compound Name | 2,3-dimethylpyrrolidin-1-amine |
|---|---|
| PubChem CID | 121486314 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | 2,3-dimethylpyrrolidin-1-amine |
| SMILES | CC1CCN(N)C1C |
| InChI | InChI=1S/C6H14N2/c1-5-3-4-8(7)6(5)2/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | JCAFOZAIKOLYIX-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|