C13H16O2 — CID 134995789
1-hydroperoxytricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene (PubChem CID 134995789) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-hydroperoxytricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene.
| Compound Name | 1-hydroperoxytricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene |
|---|---|
| PubChem CID | 134995789 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 1-hydroperoxytricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene |
| SMILES | OOC12CCCCc3cccc(c31)CC2 |
| InChI | InChI=1S/C13H16O2/c14-15-13-8-2-1-4-10-5-3-6-11(7-9-13)12(10)13/h3,5-6,14H,1-2,4,7-9H2 |
| InChIKey | YSHZTAOJCAQCGY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|