C13H18O2S — CID 134995847
S-phenyl (2R,3R)-3-hydroxy-2,4-dimethylpentanethioate (PubChem CID 134995847) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is S-phenyl (2R,3R)-3-hydroxy-2,4-dimethylpentanethioate.
| Compound Name | S-phenyl (2R,3R)-3-hydroxy-2,4-dimethylpentanethioate |
|---|---|
| PubChem CID | 134995847 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | S-phenyl (2R,3R)-3-hydroxy-2,4-dimethylpentanethioate |
| SMILES | CC(C)[C@@H](O)[C@@H](C)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C13H18O2S/c1-9(2)12(14)10(3)13(15)16-11-7-5-4-6-8-11/h4-10,12,14H,1-3H3/t10-,12-/m1/s1 |
| InChIKey | UUCNITFRNHUGLE-ZYHUDNBSSA-N |
| XLogP | 2.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|