C6H10OS — CID 13499633
2,4,5-trimethyl-1,3-oxathiole (PubChem CID 13499633) has the molecular formula C6H10OS and a molecular weight of 130.21 g/mol. Its IUPAC name is 2,4,5-trimethyl-1,3-oxathiole.
| Compound Name | 2,4,5-trimethyl-1,3-oxathiole |
|---|---|
| PubChem CID | 13499633 |
| Molecular Formula | C6H10OS |
| Molecular Weight | 130.21 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | 2,4,5-trimethyl-1,3-oxathiole |
| SMILES | CC1=C(C)SC(C)O1 |
| InChI | InChI=1S/C6H10OS/c1-4-5(2)8-6(3)7-4/h6H,1-3H3 |
| InChIKey | YYJWEOBSJSKHHU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |