C12H9N3O4 — CID 134996716
5-(2,4-dihydroxybenzoyl)pyrazine-2-carboxamide (PubChem CID 134996716) has the molecular formula C12H9N3O4 and a molecular weight of 259.22 g/mol. Its IUPAC name is 5-(2,4-dihydroxybenzoyl)pyrazine-2-carboxamide.
| Compound Name | 5-(2,4-dihydroxybenzoyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 134996716 |
| Molecular Formula | C12H9N3O4 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 5-(2,4-dihydroxybenzoyl)pyrazine-2-carboxamide |
| SMILES | NC(=O)c1cnc(C(=O)c2ccc(O)cc2O)cn1 |
| InChI | InChI=1S/C12H9N3O4/c13-12(19)9-5-14-8(4-15-9)11(18)7-2-1-6(16)3-10(7)17/h1-5,16-17H,(H2,13,19) |
| InChIKey | NBQUIJXETRZRPT-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |