C41H58O8Si2 — CID 134998191
2',2'-ditert-butyl-4,6-bis(phenylmethoxy)-8'-triethylsilyloxyspiro[1H-2-benzofuran-3,6'-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3,2]dioxasiline]-7'-ol (PubChem CID 134998191) has the molecular formula C41H58O8Si2 and a molecular weight of 735.08 g/mol. Its IUPAC name is 2',2'-ditert-butyl-4,6-bis(phenylmethoxy)-8'-triethylsilyloxyspiro[1H-2-benzofuran-3,6'-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3,2]dioxasiline]-7'-ol.
| Compound Name | 2',2'-ditert-butyl-4,6-bis(phenylmethoxy)-8'-triethylsilyloxyspiro[1H-2-benzofuran-3,6'-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3,2]dioxasiline]-7'-ol |
|---|---|
| PubChem CID | 134998191 |
| Molecular Formula | C41H58O8Si2 |
| Molecular Weight | 735.08 g/mol |
| Exact Mass | 734.37 |
| IUPAC Name | 2',2'-ditert-butyl-4,6-bis(phenylmethoxy)-8'-triethylsilyloxyspiro[1H-2-benzofuran-3,6'-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3,2]dioxasiline]-7'-ol |
| SMILES | CC[Si](CC)(CC)OC1C2O[Si](C(C)(C)C)(C(C)(C)C)OCC2OC2(OCc3cc(OCc4ccccc4)cc(OCc4ccccc4)c32)C1O |
| InChI | InChI=1S/C41H58O8Si2/c1-10-50(11-2,12-3)48-37-36-34(28-46-51(49-36,39(4,5)6)40(7,8)9)47-41(38(37)42)35-31(27-45-41)23-32(43-25-29-19-15-13-16-20-29)24-33(35)44-26-30-21-17-14-18-22-30/h13-24,34,36-38,42H,10-12,25-28H2,1-9H3 |
| InChIKey | RMUKWFWYVGPMSF-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.08 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|