C29H29NOS — CID 134999218
3-benzyl-3-[(Z)-2-benzylsulfanylethenyl]-5-phenyl-1-propan-2-ylpyrrol-2-one (PubChem CID 134999218) has the molecular formula C29H29NOS and a molecular weight of 439.62 g/mol. Its IUPAC name is 3-benzyl-3-[(Z)-2-benzylsulfanylethenyl]-5-phenyl-1-propan-2-ylpyrrol-2-one.
| Compound Name | 3-benzyl-3-[(Z)-2-benzylsulfanylethenyl]-5-phenyl-1-propan-2-ylpyrrol-2-one |
|---|---|
| PubChem CID | 134999218 |
| Molecular Formula | C29H29NOS |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 3-benzyl-3-[(Z)-2-benzylsulfanylethenyl]-5-phenyl-1-propan-2-ylpyrrol-2-one |
| SMILES | CC(C)N1C(=O)C(/C=C\SCc2ccccc2)(Cc2ccccc2)C=C1c1ccccc1 |
| InChI | InChI=1S/C29H29NOS/c1-23(2)30-27(26-16-10-5-11-17-26)21-29(28(30)31,20-24-12-6-3-7-13-24)18-19-32-22-25-14-8-4-9-15-25/h3-19,21,23H,20,22H2,1-2H3/b19-18- |
| InChIKey | KCIRDJNDJIZPSC-HNENSFHCSA-N |
| XLogP | 6.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |