C17H25NO5S — CID 134999350
(2S,3S)-2-methyl-2-(4-nitrophenyl)-3-octylsulfonyloxirane (PubChem CID 134999350) has the molecular formula C17H25NO5S and a molecular weight of 355.46 g/mol. Its IUPAC name is (2S,3S)-2-methyl-2-(4-nitrophenyl)-3-octylsulfonyloxirane.
| Compound Name | (2S,3S)-2-methyl-2-(4-nitrophenyl)-3-octylsulfonyloxirane |
|---|---|
| PubChem CID | 134999350 |
| Molecular Formula | C17H25NO5S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (2S,3S)-2-methyl-2-(4-nitrophenyl)-3-octylsulfonyloxirane |
| SMILES | CCCCCCCCS(=O)(=O)[C@@H]1O[C@@]1(C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H25NO5S/c1-3-4-5-6-7-8-13-24(21,22)16-17(2,23-16)14-9-11-15(12-10-14)18(19)20/h9-12,16H,3-8,13H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | IPYXCPHZYQNJJQ-IRXDYDNUSA-N |
| XLogP | 3.94 |
| TPSA | 89.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|