C14H16N2O4S — CID 42599215
[(2S,4R,6R)-4-hydroxy-4-methyl-6-(4-nitrophenyl)oxan-2-yl]methyl thiocyanate (PubChem CID 42599215) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is [(2S,4R,6R)-4-hydroxy-4-methyl-6-(4-nitrophenyl)oxan-2-yl]methyl thiocyanate.
| Compound Name | [(2S,4R,6R)-4-hydroxy-4-methyl-6-(4-nitrophenyl)oxan-2-yl]methyl thiocyanate |
|---|---|
| PubChem CID | 42599215 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | [(2S,4R,6R)-4-hydroxy-4-methyl-6-(4-nitrophenyl)oxan-2-yl]methyl thiocyanate |
| SMILES | C[C@]1(O)C[C@@H](CSC#N)O[C@@H](c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C14H16N2O4S/c1-14(17)6-12(8-21-9-15)20-13(7-14)10-2-4-11(5-3-10)16(18)19/h2-5,12-13,17H,6-8H2,1H3/t12-,13+,14-/m0/s1 |
| InChIKey | AININMBFVYBCEE-MJBXVCDLSA-N |
| XLogP | 2.78 |
| TPSA | 96.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|