C15H21NO4S — CID 42599214
(2S,4R,6R)-2-(ethylsulfanylmethyl)-4-methyl-6-(4-nitrophenyl)oxan-4-ol (PubChem CID 42599214) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is (2S,4R,6R)-2-(ethylsulfanylmethyl)-4-methyl-6-(4-nitrophenyl)oxan-4-ol.
| Compound Name | (2S,4R,6R)-2-(ethylsulfanylmethyl)-4-methyl-6-(4-nitrophenyl)oxan-4-ol |
|---|---|
| PubChem CID | 42599214 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (2S,4R,6R)-2-(ethylsulfanylmethyl)-4-methyl-6-(4-nitrophenyl)oxan-4-ol |
| SMILES | CCSC[C@@H]1C[C@](C)(O)C[C@H](c2ccc([N+](=O)[O-])cc2)O1 |
| InChI | InChI=1S/C15H21NO4S/c1-3-21-10-13-8-15(2,17)9-14(20-13)11-4-6-12(7-5-11)16(18)19/h4-7,13-14,17H,3,8-10H2,1-2H3/t13-,14+,15-/m0/s1 |
| InChIKey | MPTDFBGZBJDDLK-ZNMIVQPWSA-N |
| XLogP | 3.32 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|