C13H12F3NO5S — CID 53436797
methyl 2-(4-nitrophenyl)-3-(trifluoromethyl)-1,4-oxathiane-3-carboxylate (PubChem CID 53436797) has the molecular formula C13H12F3NO5S and a molecular weight of 351.30 g/mol. Its IUPAC name is methyl 2-(4-nitrophenyl)-3-(trifluoromethyl)-1,4-oxathiane-3-carboxylate.
| Compound Name | methyl 2-(4-nitrophenyl)-3-(trifluoromethyl)-1,4-oxathiane-3-carboxylate |
|---|---|
| PubChem CID | 53436797 |
| Molecular Formula | C13H12F3NO5S |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | methyl 2-(4-nitrophenyl)-3-(trifluoromethyl)-1,4-oxathiane-3-carboxylate |
| SMILES | COC(=O)C1(C(F)(F)F)SCCOC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H12F3NO5S/c1-21-11(18)12(13(14,15)16)10(22-6-7-23-12)8-2-4-9(5-3-8)17(19)20/h2-5,10H,6-7H2,1H3 |
| InChIKey | JFVLEAVWTZLFPJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|