C16H22O2 — CID 135002178
8-tert-butyl-6-methoxy-2,2-dimethylchromene (PubChem CID 135002178) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 8-tert-butyl-6-methoxy-2,2-dimethylchromene.
| Compound Name | 8-tert-butyl-6-methoxy-2,2-dimethylchromene |
|---|---|
| PubChem CID | 135002178 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 8-tert-butyl-6-methoxy-2,2-dimethylchromene |
| SMILES | COc1cc2c(c(C(C)(C)C)c1)OC(C)(C)C=C2 |
| InChI | InChI=1S/C16H22O2/c1-15(2,3)13-10-12(17-6)9-11-7-8-16(4,5)18-14(11)13/h7-10H,1-6H3 |
| InChIKey | PMSXGMHWPFMUIW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |