C26H26N2O2 — CID 135002299
(4S,5R)-3-benzyl-2,4-diphenyl-5-propan-2-yl-4H-imidazole-5-carboxylic acid (PubChem CID 135002299) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is (4S,5R)-3-benzyl-2,4-diphenyl-5-propan-2-yl-4H-imidazole-5-carboxylic acid.
| Compound Name | (4S,5R)-3-benzyl-2,4-diphenyl-5-propan-2-yl-4H-imidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 135002299 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (4S,5R)-3-benzyl-2,4-diphenyl-5-propan-2-yl-4H-imidazole-5-carboxylic acid |
| SMILES | CC(C)[C@@]1(C(=O)O)N=C(c2ccccc2)N(Cc2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C26H26N2O2/c1-19(2)26(25(29)30)23(21-14-8-4-9-15-21)28(18-20-12-6-3-7-13-20)24(27-26)22-16-10-5-11-17-22/h3-17,19,23H,18H2,1-2H3,(H,29,30)/t23-,26+/m0/s1 |
| InChIKey | RQQFZNXBCHHDNX-JYFHCDHNSA-N |
| XLogP | 5.17 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |