C24H22N2O2 — CID 135002305
(4S,5R)-3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylic acid (PubChem CID 135002305) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is (4S,5R)-3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylic acid.
| Compound Name | (4S,5R)-3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 135002305 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (4S,5R)-3-benzyl-5-methyl-2,4-diphenyl-4H-imidazole-5-carboxylic acid |
| SMILES | C[C@@]1(C(=O)O)N=C(c2ccccc2)N(Cc2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H22N2O2/c1-24(23(27)28)21(19-13-7-3-8-14-19)26(17-18-11-5-2-6-12-18)22(25-24)20-15-9-4-10-16-20/h2-16,21H,17H2,1H3,(H,27,28)/t21-,24+/m0/s1 |
| InChIKey | DBWDTHQDQGJSGW-XUZZJYLKSA-N |
| XLogP | 4.53 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |