C23H30F12O5Si — CID 135003343
bis(1,1,1,3,3,3-hexafluoropropan-2-yl) (1R,3R,6R,7S)-6-[tert-butyl(dimethyl)silyl]oxy-1-methylbicyclo[4.2.0]octane-3,7-dicarboxylate (PubChem CID 135003343) has the molecular formula C23H30F12O5Si and a molecular weight of 642.55 g/mol. Its IUPAC name is bis(1,1,1,3,3,3-hexafluoropropan-2-yl) (1R,3R,6R,7S)-6-[tert-butyl(dimethyl)silyl]oxy-1-methylbicyclo[4.2.0]octane-3,7-dicarboxylate.
| Compound Name | bis(1,1,1,3,3,3-hexafluoropropan-2-yl) (1R,3R,6R,7S)-6-[tert-butyl(dimethyl)silyl]oxy-1-methylbicyclo[4.2.0]octane-3,7-dicarboxylate |
|---|---|
| PubChem CID | 135003343 |
| Molecular Formula | C23H30F12O5Si |
| Molecular Weight | 642.55 g/mol |
| Exact Mass | 642.17 |
| IUPAC Name | bis(1,1,1,3,3,3-hexafluoropropan-2-yl) (1R,3R,6R,7S)-6-[tert-butyl(dimethyl)silyl]oxy-1-methylbicyclo[4.2.0]octane-3,7-dicarboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@]12CC[C@@H](C(=O)OC(C(F)(F)F)C(F)(F)F)C[C@]1(C)C[C@@H]2C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H30F12O5Si/c1-17(2,3)41(5,6)40-19-8-7-11(13(36)38-15(20(24,25)26)21(27,28)29)9-18(19,4)10-12(19)14(37)39-16(22(30,31)32)23(33,34)35/h11-12,15-16H,7-10H2,1-6H3/t11-,12-,18-,19-/m1/s1 |
| InChIKey | GLNVWLSCMLNFEQ-DPUOIFSFSA-N |
| XLogP | 7.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.55 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|