C22H28F12O5Si — CID 135002931
bis(1,1,1,3,3,3-hexafluoropropan-2-yl) (1R,3R,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxybicyclo[4.2.0]octane-3,7-dicarboxylate (PubChem CID 135002931) has the molecular formula C22H28F12O5Si and a molecular weight of 628.52 g/mol. Its IUPAC name is bis(1,1,1,3,3,3-hexafluoropropan-2-yl) (1R,3R,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxybicyclo[4.2.0]octane-3,7-dicarboxylate.
| Compound Name | bis(1,1,1,3,3,3-hexafluoropropan-2-yl) (1R,3R,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxybicyclo[4.2.0]octane-3,7-dicarboxylate |
|---|---|
| PubChem CID | 135002931 |
| Molecular Formula | C22H28F12O5Si |
| Molecular Weight | 628.52 g/mol |
| Exact Mass | 628.15 |
| IUPAC Name | bis(1,1,1,3,3,3-hexafluoropropan-2-yl) (1R,3R,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxybicyclo[4.2.0]octane-3,7-dicarboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@]12CC[C@@H](C(=O)OC(C(F)(F)F)C(F)(F)F)C[C@@H]1C[C@@H]2C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H28F12O5Si/c1-17(2,3)40(4,5)39-18-7-6-10(13(35)37-15(19(23,24)25)20(26,27)28)8-11(18)9-12(18)14(36)38-16(21(29,30)31)22(32,33)34/h10-12,15-16H,6-9H2,1-5H3/t10-,11-,12-,18+/m1/s1 |
| InChIKey | MSWZRJTYPACERS-DEDUFFMVSA-N |
| XLogP | 7.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.52 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|