C20H32O4 — CID 135004131
(1S,2R,4S,5S,9S,10E,13R)-2,4-dihydroxy-1,5,9,12,12-pentamethyl-16-oxabicyclo[11.2.1]hexadeca-7,10-dien-3-one (PubChem CID 135004131) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (1S,2R,4S,5S,9S,10E,13R)-2,4-dihydroxy-1,5,9,12,12-pentamethyl-16-oxabicyclo[11.2.1]hexadeca-7,10-dien-3-one.
| Compound Name | (1S,2R,4S,5S,9S,10E,13R)-2,4-dihydroxy-1,5,9,12,12-pentamethyl-16-oxabicyclo[11.2.1]hexadeca-7,10-dien-3-one |
|---|---|
| PubChem CID | 135004131 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (1S,2R,4S,5S,9S,10E,13R)-2,4-dihydroxy-1,5,9,12,12-pentamethyl-16-oxabicyclo[11.2.1]hexadeca-7,10-dien-3-one |
| SMILES | C[C@H]1C=CC[C@H](C)[C@H](O)C(=O)[C@H](O)[C@]2(C)CC[C@@H](O2)C(C)(C)/C=C/1 |
| InChI | InChI=1S/C20H32O4/c1-13-7-6-8-14(2)16(21)17(22)18(23)20(5)12-10-15(24-20)19(3,4)11-9-13/h6-7,9,11,13-16,18,21,23H,8,10,12H2,1-5H3/b7-6?,11-9+/t13-,14-,15+,16-,18-,20-/m0/s1 |
| InChIKey | UGVMWTDYEHIIBS-UKIPMYPMSA-N |
| XLogP | 3.03 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|