C22H36O4 — CID 135010682
(1S,3R,4R)-1-[(2R,5S)-5-[(3E,5R)-2,5-dimethylhepta-3,6-dien-2-yl]-2-methyloxolan-2-yl]-1,3-dihydroxy-4-methylhept-6-en-2-one (PubChem CID 135010682) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is (1S,3R,4R)-1-[(2R,5S)-5-[(3E,5R)-2,5-dimethylhepta-3,6-dien-2-yl]-2-methyloxolan-2-yl]-1,3-dihydroxy-4-methylhept-6-en-2-one.
| Compound Name | (1S,3R,4R)-1-[(2R,5S)-5-[(3E,5R)-2,5-dimethylhepta-3,6-dien-2-yl]-2-methyloxolan-2-yl]-1,3-dihydroxy-4-methylhept-6-en-2-one |
|---|---|
| PubChem CID | 135010682 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | (1S,3R,4R)-1-[(2R,5S)-5-[(3E,5R)-2,5-dimethylhepta-3,6-dien-2-yl]-2-methyloxolan-2-yl]-1,3-dihydroxy-4-methylhept-6-en-2-one |
| SMILES | C=CC[C@@H](C)[C@@H](O)C(=O)[C@@H](O)[C@@]1(C)CC[C@@H](C(C)(C)/C=C/[C@H](C)C=C)O1 |
| InChI | InChI=1S/C22H36O4/c1-8-10-16(4)18(23)19(24)20(25)22(7)14-12-17(26-22)21(5,6)13-11-15(3)9-2/h8-9,11,13,15-18,20,23,25H,1-2,10,12,14H2,3-7H3/b13-11+/t15-,16-,17+,18-,20-,22-/m1/s1 |
| InChIKey | CGYUPWKMUYRBRR-GODBGXDFSA-N |
| XLogP | 3.83 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|