C12H16O2W — CID 135004188
[methoxy-(7-prop-1-en-2-yl-2-oxabicyclo[4.2.0]oct-7-en-8-yl)methylidene]tungsten (PubChem CID 135004188) has the molecular formula C12H16O2W and a molecular weight of 376.10 g/mol. Its IUPAC name is [methoxy-(7-prop-1-en-2-yl-2-oxabicyclo[4.2.0]oct-7-en-8-yl)methylidene]tungsten.
| Compound Name | [methoxy-(7-prop-1-en-2-yl-2-oxabicyclo[4.2.0]oct-7-en-8-yl)methylidene]tungsten |
|---|---|
| PubChem CID | 135004188 |
| Molecular Formula | C12H16O2W |
| Molecular Weight | 376.10 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | [methoxy-(7-prop-1-en-2-yl-2-oxabicyclo[4.2.0]oct-7-en-8-yl)methylidene]tungsten |
| SMILES | C=C(C)C1=C(C(=[W])OC)C2OCCCC12 |
| InChI | InChI=1S/C12H16O2.W/c1-8(2)11-9-5-4-6-14-12(9)10(11)7-13-3;/h9,12H,1,4-6H2,2-3H3; |
| InChIKey | SJSOAGLCEKCSKZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.10 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |