C14H18O2W — CID 135004761
[[7-(cyclopenten-1-yl)-2-oxabicyclo[4.2.0]oct-7-en-8-yl]-methoxymethylidene]tungsten (PubChem CID 135004761) has the molecular formula C14H18O2W and a molecular weight of 402.14 g/mol. Its IUPAC name is [[7-(cyclopenten-1-yl)-2-oxabicyclo[4.2.0]oct-7-en-8-yl]-methoxymethylidene]tungsten.
| Compound Name | [[7-(cyclopenten-1-yl)-2-oxabicyclo[4.2.0]oct-7-en-8-yl]-methoxymethylidene]tungsten |
|---|---|
| PubChem CID | 135004761 |
| Molecular Formula | C14H18O2W |
| Molecular Weight | 402.14 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | [[7-(cyclopenten-1-yl)-2-oxabicyclo[4.2.0]oct-7-en-8-yl]-methoxymethylidene]tungsten |
| SMILES | COC(=[W])C1=C(C2=CCCC2)C2CCCOC12 |
| InChI | InChI=1S/C14H18O2.W/c1-15-9-12-13(10-5-2-3-6-10)11-7-4-8-16-14(11)12;/h5,11,14H,2-4,6-8H2,1H3; |
| InChIKey | NYPOKECLDSULOJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.14 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |