C15H15Cl3O3 — CID 135005298
(3aR,4R,6S,7aR)-3,3,4-trichloro-6-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one (PubChem CID 135005298) has the molecular formula C15H15Cl3O3 and a molecular weight of 349.64 g/mol. Its IUPAC name is (3aR,4R,6S,7aR)-3,3,4-trichloro-6-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one.
| Compound Name | (3aR,4R,6S,7aR)-3,3,4-trichloro-6-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one |
|---|---|
| PubChem CID | 135005298 |
| Molecular Formula | C15H15Cl3O3 |
| Molecular Weight | 349.64 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | (3aR,4R,6S,7aR)-3,3,4-trichloro-6-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one |
| SMILES | O=C1O[C@@H]2C[C@H](OCc3ccccc3)C[C@@H](Cl)[C@@H]2C1(Cl)Cl |
| InChI | InChI=1S/C15H15Cl3O3/c16-11-6-10(20-8-9-4-2-1-3-5-9)7-12-13(11)15(17,18)14(19)21-12/h1-5,10-13H,6-8H2/t10-,11-,12-,13+/m1/s1 |
| InChIKey | ANFDNTWUXASRME-LPWJVIDDSA-N |
| XLogP | 3.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.64 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|