C17H10ClF3N2 — CID 135006305
5-chloro-2,4-diphenyl-6-(trifluoromethyl)pyrimidine (PubChem CID 135006305) has the molecular formula C17H10ClF3N2 and a molecular weight of 334.73 g/mol. Its IUPAC name is 5-chloro-2,4-diphenyl-6-(trifluoromethyl)pyrimidine.
| Compound Name | 5-chloro-2,4-diphenyl-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 135006305 |
| Molecular Formula | C17H10ClF3N2 |
| Molecular Weight | 334.73 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 5-chloro-2,4-diphenyl-6-(trifluoromethyl)pyrimidine |
| SMILES | FC(F)(F)c1nc(-c2ccccc2)nc(-c2ccccc2)c1Cl |
| InChI | InChI=1S/C17H10ClF3N2/c18-13-14(11-7-3-1-4-8-11)22-16(12-9-5-2-6-10-12)23-15(13)17(19,20)21/h1-10H |
| InChIKey | KTALNXPLLNPFHJ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.73 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |