C22H26O4S — CID 135007034
(3S,4S,5R)-3-(benzenesulfonyl)-5-pentyl-4-phenyloxan-2-one (PubChem CID 135007034) has the molecular formula C22H26O4S and a molecular weight of 386.51 g/mol. Its IUPAC name is (3S,4S,5R)-3-(benzenesulfonyl)-5-pentyl-4-phenyloxan-2-one.
| Compound Name | (3S,4S,5R)-3-(benzenesulfonyl)-5-pentyl-4-phenyloxan-2-one |
|---|---|
| PubChem CID | 135007034 |
| Molecular Formula | C22H26O4S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (3S,4S,5R)-3-(benzenesulfonyl)-5-pentyl-4-phenyloxan-2-one |
| SMILES | CCCCC[C@H]1COC(=O)[C@@H](S(=O)(=O)c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H26O4S/c1-2-3-6-13-18-16-26-22(23)21(20(18)17-11-7-4-8-12-17)27(24,25)19-14-9-5-10-15-19/h4-5,7-12,14-15,18,20-21H,2-3,6,13,16H2,1H3/t18-,20+,21-/m0/s1 |
| InChIKey | GYFTVUIAMLRAPY-TYPHKJRUSA-N |
| XLogP | 4.37 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|