C34H64O4Si2 — CID 135010684
(1S,3R,4R)-1-[(2R,5S)-5-[(3E,5R)-2,5-dimethylhepta-3,6-dien-2-yl]-2-methyloxolan-2-yl]-4-methyl-1,3-bis(triethylsilyloxy)hept-6-en-2-one (PubChem CID 135010684) has the molecular formula C34H64O4Si2 and a molecular weight of 593.05 g/mol. Its IUPAC name is (1S,3R,4R)-1-[(2R,5S)-5-[(3E,5R)-2,5-dimethylhepta-3,6-dien-2-yl]-2-methyloxolan-2-yl]-4-methyl-1,3-bis(triethylsilyloxy)hept-6-en-2-one.
| Compound Name | (1S,3R,4R)-1-[(2R,5S)-5-[(3E,5R)-2,5-dimethylhepta-3,6-dien-2-yl]-2-methyloxolan-2-yl]-4-methyl-1,3-bis(triethylsilyloxy)hept-6-en-2-one |
|---|---|
| PubChem CID | 135010684 |
| Molecular Formula | C34H64O4Si2 |
| Molecular Weight | 593.05 g/mol |
| Exact Mass | 592.43 |
| IUPAC Name | (1S,3R,4R)-1-[(2R,5S)-5-[(3E,5R)-2,5-dimethylhepta-3,6-dien-2-yl]-2-methyloxolan-2-yl]-4-methyl-1,3-bis(triethylsilyloxy)hept-6-en-2-one |
| SMILES | C=CC[C@@H](C)[C@@H](O[Si](CC)(CC)CC)C(=O)[C@@H](O[Si](CC)(CC)CC)[C@@]1(C)CC[C@@H](C(C)(C)/C=C/[C@H](C)C=C)O1 |
| InChI | InChI=1S/C34H64O4Si2/c1-14-22-28(10)31(37-39(16-3,17-4)18-5)30(35)32(38-40(19-6,20-7)21-8)34(13)26-24-29(36-34)33(11,12)25-23-27(9)15-2/h14-15,23,25,27-29,31-32H,1-2,16-22,24,26H2,3-13H3/b25-23+/t27-,28-,29+,31-,32-,34-/m1/s1 |
| InChIKey | CQTYMGAKRMKJGJ-ANOMHIIBSA-N |
| XLogP | 9.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.05 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|