C32H60O4Si2 — CID 135010685
(1R,2S,4R,5R,7E,9R,10E,13S)-1,5,9,12,12-pentamethyl-2,4-bis(triethylsilyloxy)-16-oxabicyclo[11.2.1]hexadeca-7,10-dien-3-one (PubChem CID 135010685) has the molecular formula C32H60O4Si2 and a molecular weight of 565.00 g/mol. Its IUPAC name is (1R,2S,4R,5R,7E,9R,10E,13S)-1,5,9,12,12-pentamethyl-2,4-bis(triethylsilyloxy)-16-oxabicyclo[11.2.1]hexadeca-7,10-dien-3-one.
| Compound Name | (1R,2S,4R,5R,7E,9R,10E,13S)-1,5,9,12,12-pentamethyl-2,4-bis(triethylsilyloxy)-16-oxabicyclo[11.2.1]hexadeca-7,10-dien-3-one |
|---|---|
| PubChem CID | 135010685 |
| Molecular Formula | C32H60O4Si2 |
| Molecular Weight | 565.00 g/mol |
| Exact Mass | 564.40 |
| IUPAC Name | (1R,2S,4R,5R,7E,9R,10E,13S)-1,5,9,12,12-pentamethyl-2,4-bis(triethylsilyloxy)-16-oxabicyclo[11.2.1]hexadeca-7,10-dien-3-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C(=O)[C@H](O[Si](CC)(CC)CC)[C@H](C)C/C=C/[C@@H](C)/C=C/C(C)(C)[C@@H]2CC[C@@]1(C)O2 |
| InChI | InChI=1S/C32H60O4Si2/c1-12-37(13-2,14-3)35-29-26(8)20-18-19-25(7)21-23-31(9,10)27-22-24-32(11,34-27)30(28(29)33)36-38(15-4,16-5)17-6/h18-19,21,23,25-27,29-30H,12-17,20,22,24H2,1-11H3/b19-18+,23-21+/t25-,26-,27+,29-,30-,32-/m1/s1 |
| InChIKey | USBTYAVHNKYOAI-DYJRJKJUSA-N |
| XLogP | 9.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.00 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|