C49H56O11 — CID 135011102
tert-butyl (6S)-3-oxo-2-(4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl)-4,5,6,8-tetrakis(phenylmethoxy)-7-prop-2-enoxyoctanoate (PubChem CID 135011102) has the molecular formula C49H56O11 and a molecular weight of 820.98 g/mol. Its IUPAC name is tert-butyl (6S)-3-oxo-2-(4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl)-4,5,6,8-tetrakis(phenylmethoxy)-7-prop-2-enoxyoctanoate.
| Compound Name | tert-butyl (6S)-3-oxo-2-(4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl)-4,5,6,8-tetrakis(phenylmethoxy)-7-prop-2-enoxyoctanoate |
|---|---|
| PubChem CID | 135011102 |
| Molecular Formula | C49H56O11 |
| Molecular Weight | 820.98 g/mol |
| Exact Mass | 820.38 |
| IUPAC Name | tert-butyl (6S)-3-oxo-2-(4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl)-4,5,6,8-tetrakis(phenylmethoxy)-7-prop-2-enoxyoctanoate |
| SMILES | C=CCOC(COCc1ccccc1)[C@H](OCc1ccccc1)C(OCc1ccccc1)C(OCc1ccccc1)C(=O)C(C(=O)OC(C)(C)C)C1CC(=O)C2OCC1O2 |
| InChI | InChI=1S/C49H56O11/c1-5-26-54-41(32-53-28-34-18-10-6-11-19-34)44(55-29-35-20-12-7-13-21-35)46(57-31-37-24-16-9-17-25-37)45(56-30-36-22-14-8-15-23-36)43(51)42(47(52)60-49(2,3)4)38-27-39(50)48-58-33-40(38)59-48/h5-25,38,40-42,44-46,48H,1,26-33H2,2-4H3/t38?,40?,41?,42?,44-,45?,46?,48?/m0/s1 |
| InChIKey | OTBHPDHSJHATRY-XSTZJEIUSA-N |
| XLogP | 7.39 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.98 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|