C29H41F3O5S — CID 135011258
[1-[(1S,2S)-2-[(4-methoxyphenyl)methoxy]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 135011258) has the molecular formula C29H41F3O5S and a molecular weight of 558.70 g/mol. Its IUPAC name is [1-[(1S,2S)-2-[(4-methoxyphenyl)methoxy]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [1-[(1S,2S)-2-[(4-methoxyphenyl)methoxy]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135011258 |
| Molecular Formula | C29H41F3O5S |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | [1-[(1S,2S)-2-[(4-methoxyphenyl)methoxy]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(CO[C@H]2CCC3CCCCC3[C@H]2C2C(OS(=O)(=O)C(F)(F)F)CCC3CCCCC32)cc1 |
| InChI | InChI=1S/C29H41F3O5S/c1-35-22-14-10-19(11-15-22)18-36-25-16-12-20-6-2-4-8-23(20)27(25)28-24-9-5-3-7-21(24)13-17-26(28)37-38(33,34)29(30,31)32/h10-11,14-15,20-21,23-28H,2-9,12-13,16-18H2,1H3/t20?,21?,23?,24?,25-,26?,27+,28?/m0/s1 |
| InChIKey | HCQHJOJPGOYXGF-DMHCVEDSSA-N |
| XLogP | 7.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|