C26H27F3O4S — CID 138969447
[(8S,9S,13S,14S)-17-(4-methoxyphenyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate (PubChem CID 138969447) has the molecular formula C26H27F3O4S and a molecular weight of 492.56 g/mol. Its IUPAC name is [(8S,9S,13S,14S)-17-(4-methoxyphenyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate.
| Compound Name | [(8S,9S,13S,14S)-17-(4-methoxyphenyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 138969447 |
| Molecular Formula | C26H27F3O4S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | [(8S,9S,13S,14S)-17-(4-methoxyphenyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(C2=CC[C@H]3[C@@H]4CCc5cc(OS(=O)(=O)C(F)(F)F)ccc5[C@H]4CC[C@]23C)cc1 |
| InChI | InChI=1S/C26H27F3O4S/c1-25-14-13-21-20-10-8-19(33-34(30,31)26(27,28)29)15-17(20)5-9-22(21)24(25)12-11-23(25)16-3-6-18(32-2)7-4-16/h3-4,6-8,10-11,15,21-22,24H,5,9,12-14H2,1-2H3/t21-,22-,24+,25-/m1/s1 |
| InChIKey | UHUKWNHNRMBZAD-YQIMAOPZSA-N |
| XLogP | 6.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|