C22H29F3O4S — CID 138975688
[3-(1-adamantyl)-4-butyl-5-methoxyphenyl] trifluoromethanesulfonate (PubChem CID 138975688) has the molecular formula C22H29F3O4S and a molecular weight of 446.53 g/mol. Its IUPAC name is [3-(1-adamantyl)-4-butyl-5-methoxyphenyl] trifluoromethanesulfonate.
| Compound Name | [3-(1-adamantyl)-4-butyl-5-methoxyphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 138975688 |
| Molecular Formula | C22H29F3O4S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | [3-(1-adamantyl)-4-butyl-5-methoxyphenyl] trifluoromethanesulfonate |
| SMILES | CCCCc1c(OC)cc(OS(=O)(=O)C(F)(F)F)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H29F3O4S/c1-3-4-5-18-19(21-11-14-6-15(12-21)8-16(7-14)13-21)9-17(10-20(18)28-2)29-30(26,27)22(23,24)25/h9-10,14-16H,3-8,11-13H2,1-2H3 |
| InChIKey | FBUJFABYAITXBZ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|