C22H15F3O6S — CID 15983933
[9-(4-methoxy-2-methylphenyl)-6-oxoxanthen-3-yl] trifluoromethanesulfonate (PubChem CID 15983933) has the molecular formula C22H15F3O6S and a molecular weight of 464.42 g/mol. Its IUPAC name is [9-(4-methoxy-2-methylphenyl)-6-oxoxanthen-3-yl] trifluoromethanesulfonate.
| Compound Name | [9-(4-methoxy-2-methylphenyl)-6-oxoxanthen-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 15983933 |
| Molecular Formula | C22H15F3O6S |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | [9-(4-methoxy-2-methylphenyl)-6-oxoxanthen-3-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(-c2c3ccc(=O)cc-3oc3cc(OS(=O)(=O)C(F)(F)F)ccc23)c(C)c1 |
| InChI | InChI=1S/C22H15F3O6S/c1-12-9-14(29-2)4-7-16(12)21-17-6-3-13(26)10-19(17)30-20-11-15(5-8-18(20)21)31-32(27,28)22(23,24)25/h3-11H,1-2H3 |
| InChIKey | JAGJGCRRONXEKG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|