C22H31F3O4SSi — CID 162407443
[3-(1-adamantyl)-5-methoxy-4-(trimethylsilylmethyl)phenyl] trifluoromethanesulfonate (PubChem CID 162407443) has the molecular formula C22H31F3O4SSi and a molecular weight of 476.63 g/mol. Its IUPAC name is [3-(1-adamantyl)-5-methoxy-4-(trimethylsilylmethyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [3-(1-adamantyl)-5-methoxy-4-(trimethylsilylmethyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162407443 |
| Molecular Formula | C22H31F3O4SSi |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | [3-(1-adamantyl)-5-methoxy-4-(trimethylsilylmethyl)phenyl] trifluoromethanesulfonate |
| SMILES | COc1cc(OS(=O)(=O)C(F)(F)F)cc(C23CC4CC(CC(C4)C2)C3)c1C[Si](C)(C)C |
| InChI | InChI=1S/C22H31F3O4SSi/c1-28-20-9-17(29-30(26,27)22(23,24)25)8-19(18(20)13-31(2,3)4)21-10-14-5-15(11-21)7-16(6-14)12-21/h8-9,14-16H,5-7,10-13H2,1-4H3 |
| InChIKey | DQBNYPVWHBXTMN-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|