About [7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylchromen-4-yl] trifluoromethanesulfonate
[7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylchromen-4-yl] trifluoromethanesulfonate (PubChem CID 59443047) has the molecular formula C19H27F3O5SSi
and a molecular weight of 452.57 g/mol. Its IUPAC name is [7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylchromen-4-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylchromen-4-yl] trifluoromethanesulfonate |
| PubChem CID | 59443047 |
| Molecular Formula | C19H27F3O5SSi |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | [7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylchromen-4-yl] trifluoromethanesulfonate |
| SMILES | Cc1cc(O[Si](C)(C)C(C)(C)C)cc2c1C(OS(=O)(=O)C(F)(F)F)=CC(C)(C)O2 |
| InChI | InChI=1S/C19H27F3O5SSi/c1-12-9-13(27-29(7,8)17(2,3)4)10-14-16(12)15(11-18(5,6)25-14)26-28(23,24)19(20,21)22/h9-11H,1-8H3 |
| InChIKey | IBFUNLGFYBGRGD-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylchromen-4-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylchromen-4-yl] trifluoromethanesulfonate?
The IUPAC name of [7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylchromen-4-yl] trifluoromethanesulfonate (CID 59443047) is [7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylchromen-4-yl] trifluoromethanesulfonate.
What is the SMILES notation for [7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylchromen-4-yl] trifluoromethanesulfonate?
The canonical SMILES for [7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylchromen-4-yl] trifluoromethanesulfonate is Cc1cc(O[Si](C)(C)C(C)(C)C)cc2c1C(OS(=O)(=O)C(F)(F)F)=CC(C)(C)O2.
What is the InChIKey of [7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylchromen-4-yl] trifluoromethanesulfonate?
The InChIKey is IBFUNLGFYBGRGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27F3O5SSi/c1-12-9-13(27-29(7,8)17(2,3)4)10-14-16(12)15(11-18(5,6)25-14)26-28(23,24)19(20,21)22/h9-11H,1-8H3.
What are the key properties of [7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylchromen-4-yl] trifluoromethanesulfonate?
[7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylchromen-4-yl] trifluoromethanesulfonate has a molecular weight of 452.57 g/mol, XLogP of 5.76, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylchromen-4-yl] trifluoromethanesulfonate is sourced from PubChem (CID 59443047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).