C19H27F3O5SSi — CID 59443047
[7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylchromen-4-yl] trifluoromethanesulfonate (PubChem CID 59443047) has the molecular formula C19H27F3O5SSi and a molecular weight of 452.57 g/mol. Its IUPAC name is [7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylchromen-4-yl] trifluoromethanesulfonate.
| Compound Name | [7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylchromen-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59443047 |
| Molecular Formula | C19H27F3O5SSi |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | [7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylchromen-4-yl] trifluoromethanesulfonate |
| SMILES | Cc1cc(O[Si](C)(C)C(C)(C)C)cc2c1C(OS(=O)(=O)C(F)(F)F)=CC(C)(C)O2 |
| InChI | InChI=1S/C19H27F3O5SSi/c1-12-9-13(27-29(7,8)17(2,3)4)10-14-16(12)15(11-18(5,6)25-14)26-28(23,24)19(20,21)22/h9-11H,1-8H3 |
| InChIKey | IBFUNLGFYBGRGD-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|