C25H37F3O6SSi — CID 162418115
[4-[(1S,2S,5S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate (PubChem CID 162418115) has the molecular formula C25H37F3O6SSi and a molecular weight of 550.71 g/mol. Its IUPAC name is [4-[(1S,2S,5S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate.
| Compound Name | [4-[(1S,2S,5S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162418115 |
| Molecular Formula | C25H37F3O6SSi |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | [4-[(1S,2S,5S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-3-enyl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate |
| SMILES | COc1cc(OS(=O)(=O)C(F)(F)F)cc(OC)c1[C@H]1C=C(CO[Si](C)(C)C(C)(C)C)[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C25H37F3O6SSi/c1-23(2,3)36(8,9)33-14-15-10-17(19-13-18(15)24(19,4)5)22-20(31-6)11-16(12-21(22)32-7)34-35(29,30)25(26,27)28/h10-12,17-19H,13-14H2,1-9H3/t17-,18+,19-/m0/s1 |
| InChIKey | DZCZJNJYZIMWPQ-OTWHNJEPSA-N |
| XLogP | 6.64 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|