C34H51F3O7SSi — CID 22033438
[4-[4-[9-[tert-butyl(dimethyl)silyl]oxynonyl]-7-(methoxymethoxy)-3-methyl-2,4-dihydrochromen-3-yl]phenyl] trifluoromethanesulfonate (PubChem CID 22033438) has the molecular formula C34H51F3O7SSi and a molecular weight of 688.92 g/mol. Its IUPAC name is [4-[4-[9-[tert-butyl(dimethyl)silyl]oxynonyl]-7-(methoxymethoxy)-3-methyl-2,4-dihydrochromen-3-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[4-[9-[tert-butyl(dimethyl)silyl]oxynonyl]-7-(methoxymethoxy)-3-methyl-2,4-dihydrochromen-3-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22033438 |
| Molecular Formula | C34H51F3O7SSi |
| Molecular Weight | 688.92 g/mol |
| Exact Mass | 688.31 |
| IUPAC Name | [4-[4-[9-[tert-butyl(dimethyl)silyl]oxynonyl]-7-(methoxymethoxy)-3-methyl-2,4-dihydrochromen-3-yl]phenyl] trifluoromethanesulfonate |
| SMILES | COCOc1ccc2c(c1)OCC(C)(c1ccc(OS(=O)(=O)C(F)(F)F)cc1)C2CCCCCCCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H51F3O7SSi/c1-32(2,3)46(6,7)43-22-14-12-10-8-9-11-13-15-30-29-21-20-28(42-25-40-5)23-31(29)41-24-33(30,4)26-16-18-27(19-17-26)44-45(38,39)34(35,36)37/h16-21,23,30H,8-15,22,24-25H2,1-7H3 |
| InChIKey | MWUMKTNWIJTGLA-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.92 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|