C23H27F3O5S — CID 88569112
[(4bR,8aR,9S)-3-methoxy-9-(4-methoxycyclohexa-2,4-dien-1-yl)-4b,5,6,7,8,8a,9,10-octahydrophenanthren-1-yl] trifluoromethanesulfonate (PubChem CID 88569112) has the molecular formula C23H27F3O5S and a molecular weight of 472.53 g/mol. Its IUPAC name is [(4bR,8aR,9S)-3-methoxy-9-(4-methoxycyclohexa-2,4-dien-1-yl)-4b,5,6,7,8,8a,9,10-octahydrophenanthren-1-yl] trifluoromethanesulfonate.
| Compound Name | [(4bR,8aR,9S)-3-methoxy-9-(4-methoxycyclohexa-2,4-dien-1-yl)-4b,5,6,7,8,8a,9,10-octahydrophenanthren-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 88569112 |
| Molecular Formula | C23H27F3O5S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | [(4bR,8aR,9S)-3-methoxy-9-(4-methoxycyclohexa-2,4-dien-1-yl)-4b,5,6,7,8,8a,9,10-octahydrophenanthren-1-yl] trifluoromethanesulfonate |
| SMILES | COC1=CCC([C@@H]2Cc3c(OS(=O)(=O)C(F)(F)F)cc(OC)cc3[C@@H]3CCCC[C@@H]32)C=C1 |
| InChI | InChI=1S/C23H27F3O5S/c1-29-15-9-7-14(8-10-15)19-13-21-20(18-6-4-3-5-17(18)19)11-16(30-2)12-22(21)31-32(27,28)23(24,25)26/h7,9-12,14,17-19H,3-6,8,13H2,1-2H3/t14?,17-,18+,19-/m0/s1 |
| InChIKey | CEGFZAGURVFULW-JVPQYHMTSA-N |
| XLogP | 5.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|