C25H23F3O4SSi — CID 122381993
(5-anthracen-9-yl-3-methoxy-2-trimethylsilylphenyl) trifluoromethanesulfonate (PubChem CID 122381993) has the molecular formula C25H23F3O4SSi and a molecular weight of 504.60 g/mol. Its IUPAC name is (5-anthracen-9-yl-3-methoxy-2-trimethylsilylphenyl) trifluoromethanesulfonate.
| Compound Name | (5-anthracen-9-yl-3-methoxy-2-trimethylsilylphenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 122381993 |
| Molecular Formula | C25H23F3O4SSi |
| Molecular Weight | 504.60 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | (5-anthracen-9-yl-3-methoxy-2-trimethylsilylphenyl) trifluoromethanesulfonate |
| SMILES | COc1cc(-c2c3ccccc3cc3ccccc23)cc(OS(=O)(=O)C(F)(F)F)c1[Si](C)(C)C |
| InChI | InChI=1S/C25H23F3O4SSi/c1-31-21-14-18(15-22(24(21)34(2,3)4)32-33(29,30)25(26,27)28)23-19-11-7-5-9-16(19)13-17-10-6-8-12-20(17)23/h5-15H,1-4H3 |
| InChIKey | LYXWNJRJRKENDD-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.60 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|