C22H29F3O5S — CID 101409545
[(4aR)-6,8-dimethoxy-1,1,4a-trimethyl-7-propan-2-yl-3,4-dihydro-2H-fluoren-9-yl] trifluoromethanesulfonate (PubChem CID 101409545) has the molecular formula C22H29F3O5S and a molecular weight of 462.53 g/mol. Its IUPAC name is [(4aR)-6,8-dimethoxy-1,1,4a-trimethyl-7-propan-2-yl-3,4-dihydro-2H-fluoren-9-yl] trifluoromethanesulfonate.
| Compound Name | [(4aR)-6,8-dimethoxy-1,1,4a-trimethyl-7-propan-2-yl-3,4-dihydro-2H-fluoren-9-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101409545 |
| Molecular Formula | C22H29F3O5S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | [(4aR)-6,8-dimethoxy-1,1,4a-trimethyl-7-propan-2-yl-3,4-dihydro-2H-fluoren-9-yl] trifluoromethanesulfonate |
| SMILES | COc1cc2c(c(OC)c1C(C)C)C(OS(=O)(=O)C(F)(F)F)=C1C(C)(C)CCC[C@@]12C |
| InChI | InChI=1S/C22H29F3O5S/c1-12(2)15-14(28-6)11-13-16(17(15)29-7)18(30-31(26,27)22(23,24)25)19-20(3,4)9-8-10-21(13,19)5/h11-12H,8-10H2,1-7H3/t21-/m1/s1 |
| InChIKey | CUOZUNLMRAUAJI-OAQYLSRUSA-N |
| XLogP | 5.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|