C23H25F3O5S — CID 59504455
[(4bR,8aR,9R)-3-methoxy-9-(4-methoxyphenyl)-4b,5,6,7,8,8a,9,10-octahydrophenanthren-1-yl] trifluoromethanesulfonate (PubChem CID 59504455) has the molecular formula C23H25F3O5S and a molecular weight of 470.51 g/mol. Its IUPAC name is [(4bR,8aR,9R)-3-methoxy-9-(4-methoxyphenyl)-4b,5,6,7,8,8a,9,10-octahydrophenanthren-1-yl] trifluoromethanesulfonate.
| Compound Name | [(4bR,8aR,9R)-3-methoxy-9-(4-methoxyphenyl)-4b,5,6,7,8,8a,9,10-octahydrophenanthren-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59504455 |
| Molecular Formula | C23H25F3O5S |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | [(4bR,8aR,9R)-3-methoxy-9-(4-methoxyphenyl)-4b,5,6,7,8,8a,9,10-octahydrophenanthren-1-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc([C@@H]2Cc3c(OS(=O)(=O)C(F)(F)F)cc(OC)cc3[C@@H]3CCCC[C@H]23)cc1 |
| InChI | InChI=1S/C23H25F3O5S/c1-29-15-9-7-14(8-10-15)19-13-21-20(18-6-4-3-5-17(18)19)11-16(30-2)12-22(21)31-32(27,28)23(24,25)26/h7-12,17-19H,3-6,13H2,1-2H3/t17-,18+,19-/m0/s1 |
| InChIKey | BXHXIZFKBBUJKC-OTWHNJEPSA-N |
| XLogP | 5.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|