C24H25F3O4S — CID 15120848
[(5R,11S)-5,11-diethyl-8-methoxy-5,6,11,12-tetrahydrochrysen-2-yl] trifluoromethanesulfonate (PubChem CID 15120848) has the molecular formula C24H25F3O4S and a molecular weight of 466.52 g/mol. Its IUPAC name is [(5R,11S)-5,11-diethyl-8-methoxy-5,6,11,12-tetrahydrochrysen-2-yl] trifluoromethanesulfonate.
| Compound Name | [(5R,11S)-5,11-diethyl-8-methoxy-5,6,11,12-tetrahydrochrysen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 15120848 |
| Molecular Formula | C24H25F3O4S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | [(5R,11S)-5,11-diethyl-8-methoxy-5,6,11,12-tetrahydrochrysen-2-yl] trifluoromethanesulfonate |
| SMILES | CC[C@@H]1Cc2cc(OC)ccc2C2=C1c1ccc(OS(=O)(=O)C(F)(F)F)cc1C[C@@H]2CC |
| InChI | InChI=1S/C24H25F3O4S/c1-4-14-10-16-12-18(30-3)6-8-20(16)22-15(5-2)11-17-13-19(7-9-21(17)23(14)22)31-32(28,29)24(25,26)27/h6-9,12-15H,4-5,10-11H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | GBRGDEBFVCTLNP-CABCVRRESA-N |
| XLogP | 6.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|